C18H21N3O6 — CID 9278201
2,4,5-trimethoxy-N-[2-(2-nitroanilino)ethyl]benzamide (PubChem CID 9278201) has the molecular formula C18H21N3O6 and a molecular weight of 375.38 g/mol. Its IUPAC name is 2,4,5-trimethoxy-N-[2-(2-nitroanilino)ethyl]benzamide.
| Compound Name | 2,4,5-trimethoxy-N-[2-(2-nitroanilino)ethyl]benzamide |
|---|---|
| PubChem CID | 9278201 |
| Molecular Formula | C18H21N3O6 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 2,4,5-trimethoxy-N-[2-(2-nitroanilino)ethyl]benzamide |
| SMILES | COc1cc(OC)c(C(=O)NCCNc2ccccc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H21N3O6/c1-25-15-11-17(27-3)16(26-2)10-12(15)18(22)20-9-8-19-13-6-4-5-7-14(13)21(23)24/h4-7,10-11,19H,8-9H2,1-3H3,(H,20,22) |
| InChIKey | ATEKNEVCKOYZIZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|