C20H20N4O5S — CID 39636641
3-methoxy-N-[2-(2-nitroanilino)ethyl]-4-(1,3-thiazol-4-ylmethoxy)benzamide (PubChem CID 39636641) has the molecular formula C20H20N4O5S and a molecular weight of 428.47 g/mol. Its IUPAC name is 3-methoxy-N-[2-(2-nitroanilino)ethyl]-4-(1,3-thiazol-4-ylmethoxy)benzamide.
| Compound Name | 3-methoxy-N-[2-(2-nitroanilino)ethyl]-4-(1,3-thiazol-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 39636641 |
| Molecular Formula | C20H20N4O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 3-methoxy-N-[2-(2-nitroanilino)ethyl]-4-(1,3-thiazol-4-ylmethoxy)benzamide |
| SMILES | COc1cc(C(=O)NCCNc2ccccc2[N+](=O)[O-])ccc1OCc1cscn1 |
| InChI | InChI=1S/C20H20N4O5S/c1-28-19-10-14(6-7-18(19)29-11-15-12-30-13-23-15)20(25)22-9-8-21-16-4-2-3-5-17(16)24(26)27/h2-7,10,12-13,21H,8-9,11H2,1H3,(H,22,25) |
| InChIKey | GMCSSIDGMYAHOR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|