C24H28N2O5S — CID 46586430
N-[2-(3,4-diethoxyphenyl)ethyl]-3-methoxy-4-(1,3-thiazol-4-ylmethoxy)benzamide (PubChem CID 46586430) has the molecular formula C24H28N2O5S and a molecular weight of 456.56 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-3-methoxy-4-(1,3-thiazol-4-ylmethoxy)benzamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-3-methoxy-4-(1,3-thiazol-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 46586430 |
| Molecular Formula | C24H28N2O5S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-3-methoxy-4-(1,3-thiazol-4-ylmethoxy)benzamide |
| SMILES | CCOc1ccc(CCNC(=O)c2ccc(OCc3cscn3)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C24H28N2O5S/c1-4-29-21-8-6-17(12-23(21)30-5-2)10-11-25-24(27)18-7-9-20(22(13-18)28-3)31-14-19-15-32-16-26-19/h6-9,12-13,15-16H,4-5,10-11,14H2,1-3H3,(H,25,27) |
| InChIKey | SPIDHSHPIUQZEE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |