C15H18N2O4S — CID 78855067
N-(2-hydroxypropyl)-3-methoxy-4-(1,3-thiazol-4-ylmethoxy)benzamide (PubChem CID 78855067) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-3-methoxy-4-(1,3-thiazol-4-ylmethoxy)benzamide.
| Compound Name | N-(2-hydroxypropyl)-3-methoxy-4-(1,3-thiazol-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 78855067 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-(2-hydroxypropyl)-3-methoxy-4-(1,3-thiazol-4-ylmethoxy)benzamide |
| SMILES | COc1cc(C(=O)NCC(C)O)ccc1OCc1cscn1 |
| InChI | InChI=1S/C15H18N2O4S/c1-10(18)6-16-15(19)11-3-4-13(14(5-11)20-2)21-7-12-8-22-9-17-12/h3-5,8-10,18H,6-7H2,1-2H3,(H,16,19) |
| InChIKey | JHGCOPYNHUYUQF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |