C20H20N2O5S — CID 46577798
N-(2,4-dimethoxyphenyl)-3-methoxy-4-(1,3-thiazol-4-ylmethoxy)benzamide (PubChem CID 46577798) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-methoxy-4-(1,3-thiazol-4-ylmethoxy)benzamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-methoxy-4-(1,3-thiazol-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 46577798 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-methoxy-4-(1,3-thiazol-4-ylmethoxy)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(OCc3cscn3)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C20H20N2O5S/c1-24-15-5-6-16(18(9-15)25-2)22-20(23)13-4-7-17(19(8-13)26-3)27-10-14-11-28-12-21-14/h4-9,11-12H,10H2,1-3H3,(H,22,23) |
| InChIKey | IXCQEQUBUOLJCR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |