C27H32N2O5 — CID 46535133
N-[2-(3,4-diethoxyphenyl)ethyl]-3-ethoxy-4-(pyridin-4-ylmethoxy)benzamide (PubChem CID 46535133) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-3-ethoxy-4-(pyridin-4-ylmethoxy)benzamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-3-ethoxy-4-(pyridin-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 46535133 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-3-ethoxy-4-(pyridin-4-ylmethoxy)benzamide |
| SMILES | CCOc1ccc(CCNC(=O)c2ccc(OCc3ccncc3)c(OCC)c2)cc1OCC |
| InChI | InChI=1S/C27H32N2O5/c1-4-31-23-9-7-20(17-25(23)32-5-2)13-16-29-27(30)22-8-10-24(26(18-22)33-6-3)34-19-21-11-14-28-15-12-21/h7-12,14-15,17-18H,4-6,13,16,19H2,1-3H3,(H,29,30) |
| InChIKey | DLITYCNZMMBSOL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |