C24H33N3O5 — CID 46480603
ethyl N-[1-[[3-ethoxy-4-(pyridin-4-ylmethoxy)benzoyl]amino]-4-methylpentan-2-yl]carbamate (PubChem CID 46480603) has the molecular formula C24H33N3O5 and a molecular weight of 443.54 g/mol. Its IUPAC name is ethyl N-[1-[[3-ethoxy-4-(pyridin-4-ylmethoxy)benzoyl]amino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[[3-ethoxy-4-(pyridin-4-ylmethoxy)benzoyl]amino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 46480603 |
| Molecular Formula | C24H33N3O5 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | ethyl N-[1-[[3-ethoxy-4-(pyridin-4-ylmethoxy)benzoyl]amino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CNC(=O)c1ccc(OCc2ccncc2)c(OCC)c1)CC(C)C |
| InChI | InChI=1S/C24H33N3O5/c1-5-30-22-14-19(7-8-21(22)32-16-18-9-11-25-12-10-18)23(28)26-15-20(13-17(3)4)27-24(29)31-6-2/h7-12,14,17,20H,5-6,13,15-16H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | SFTFQFFGPAUUBH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |