C17H23N3O3 — CID 38931311
ethyl N-[(2S)-1-[(3-cyanobenzoyl)amino]-4-methylpentan-2-yl]carbamate (PubChem CID 38931311) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is ethyl N-[(2S)-1-[(3-cyanobenzoyl)amino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[(2S)-1-[(3-cyanobenzoyl)amino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 38931311 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | ethyl N-[(2S)-1-[(3-cyanobenzoyl)amino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCOC(=O)N[C@H](CNC(=O)c1cccc(C#N)c1)CC(C)C |
| InChI | InChI=1S/C17H23N3O3/c1-4-23-17(22)20-15(8-12(2)3)11-19-16(21)14-7-5-6-13(9-14)10-18/h5-7,9,12,15H,4,8,11H2,1-3H3,(H,19,21)(H,20,22)/t15-/m0/s1 |
| InChIKey | VIMLSDCHVZUHFQ-HNNXBMFYSA-N |
| XLogP | 2.45 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |