C17H27N3O5S — CID 46432540
ethyl N-[4-methyl-1-[[4-(methylsulfamoyl)benzoyl]amino]pentan-2-yl]carbamate (PubChem CID 46432540) has the molecular formula C17H27N3O5S and a molecular weight of 385.49 g/mol. Its IUPAC name is ethyl N-[4-methyl-1-[[4-(methylsulfamoyl)benzoyl]amino]pentan-2-yl]carbamate.
| Compound Name | ethyl N-[4-methyl-1-[[4-(methylsulfamoyl)benzoyl]amino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 46432540 |
| Molecular Formula | C17H27N3O5S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | ethyl N-[4-methyl-1-[[4-(methylsulfamoyl)benzoyl]amino]pentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CNC(=O)c1ccc(S(=O)(=O)NC)cc1)CC(C)C |
| InChI | InChI=1S/C17H27N3O5S/c1-5-25-17(22)20-14(10-12(2)3)11-19-16(21)13-6-8-15(9-7-13)26(23,24)18-4/h6-9,12,14,18H,5,10-11H2,1-4H3,(H,19,21)(H,20,22) |
| InChIKey | USFSXNZCXQJTCY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |