C16H26N2O3S — CID 60566688
ethyl N-[1-[(3-ethylthiophene-2-carbonyl)amino]-4-methylpentan-2-yl]carbamate (PubChem CID 60566688) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is ethyl N-[1-[(3-ethylthiophene-2-carbonyl)amino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[(3-ethylthiophene-2-carbonyl)amino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 60566688 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | ethyl N-[1-[(3-ethylthiophene-2-carbonyl)amino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CNC(=O)c1sccc1CC)CC(C)C |
| InChI | InChI=1S/C16H26N2O3S/c1-5-12-7-8-22-14(12)15(19)17-10-13(9-11(3)4)18-16(20)21-6-2/h7-8,11,13H,5-6,9-10H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | JMAXEAUTFCGEGD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |