C19H29N3O4 — CID 55654735
ethyl N-[4-methyl-1-[[2-[(2-phenylacetyl)amino]acetyl]amino]pentan-2-yl]carbamate (PubChem CID 55654735) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is ethyl N-[4-methyl-1-[[2-[(2-phenylacetyl)amino]acetyl]amino]pentan-2-yl]carbamate.
| Compound Name | ethyl N-[4-methyl-1-[[2-[(2-phenylacetyl)amino]acetyl]amino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 55654735 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | ethyl N-[4-methyl-1-[[2-[(2-phenylacetyl)amino]acetyl]amino]pentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CNC(=O)CNC(=O)Cc1ccccc1)CC(C)C |
| InChI | InChI=1S/C19H29N3O4/c1-4-26-19(25)22-16(10-14(2)3)12-20-18(24)13-21-17(23)11-15-8-6-5-7-9-15/h5-9,14,16H,4,10-13H2,1-3H3,(H,20,24)(H,21,23)(H,22,25) |
| InChIKey | XOHJNQNKAVZBCL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |