C19H24N2O5 — CID 55654736
ethyl N-[4-methyl-1-[(4-oxochromene-2-carbonyl)amino]pentan-2-yl]carbamate (PubChem CID 55654736) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is ethyl N-[4-methyl-1-[(4-oxochromene-2-carbonyl)amino]pentan-2-yl]carbamate.
| Compound Name | ethyl N-[4-methyl-1-[(4-oxochromene-2-carbonyl)amino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 55654736 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | ethyl N-[4-methyl-1-[(4-oxochromene-2-carbonyl)amino]pentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CNC(=O)c1cc(=O)c2ccccc2o1)CC(C)C |
| InChI | InChI=1S/C19H24N2O5/c1-4-25-19(24)21-13(9-12(2)3)11-20-18(23)17-10-15(22)14-7-5-6-8-16(14)26-17/h5-8,10,12-13H,4,9,11H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | OTCQAVRGQLHDKG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |