C14H13NO5 — CID 62675118
2-methyl-3-[(4-oxochromene-2-carbonyl)amino]propanoic acid (PubChem CID 62675118) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-methyl-3-[(4-oxochromene-2-carbonyl)amino]propanoic acid.
| Compound Name | 2-methyl-3-[(4-oxochromene-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 62675118 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-methyl-3-[(4-oxochromene-2-carbonyl)amino]propanoic acid |
| SMILES | CC(CNC(=O)c1cc(=O)c2ccccc2o1)C(=O)O |
| InChI | InChI=1S/C14H13NO5/c1-8(14(18)19)7-15-13(17)12-6-10(16)9-4-2-3-5-11(9)20-12/h2-6,8H,7H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | WFUOIGFHGFNHQM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |