C20H19NO5 — CID 90598011
N-[2-methoxy-2-(2-methoxyphenyl)ethyl]-4-oxochromene-2-carboxamide (PubChem CID 90598011) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is N-[2-methoxy-2-(2-methoxyphenyl)ethyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[2-methoxy-2-(2-methoxyphenyl)ethyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 90598011 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-[2-methoxy-2-(2-methoxyphenyl)ethyl]-4-oxochromene-2-carboxamide |
| SMILES | COc1ccccc1C(CNC(=O)c1cc(=O)c2ccccc2o1)OC |
| InChI | InChI=1S/C20H19NO5/c1-24-16-9-5-4-8-14(16)19(25-2)12-21-20(23)18-11-15(22)13-7-3-6-10-17(13)26-18/h3-11,19H,12H2,1-2H3,(H,21,23) |
| InChIKey | LVBIIMGSMPEULW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |