C23H25N2O4+ — CID 9112450
N-[(2S)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]-4-oxochromene-2-carboxamide (PubChem CID 9112450) has the molecular formula C23H25N2O4+ and a molecular weight of 393.46 g/mol. Its IUPAC name is N-[(2S)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[(2S)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 9112450 |
| Molecular Formula | C23H25N2O4+ |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-[(2S)-2-(2-methoxyphenyl)-2-pyrrolidin-1-ium-1-ylethyl]-4-oxochromene-2-carboxamide |
| SMILES | COc1ccccc1[C@@H](CNC(=O)c1cc(=O)c2ccccc2o1)[NH+]1CCCC1 |
| InChI | InChI=1S/C23H24N2O4/c1-28-20-10-4-2-8-16(20)18(25-12-6-7-13-25)15-24-23(27)22-14-19(26)17-9-3-5-11-21(17)29-22/h2-5,8-11,14,18H,6-7,12-13,15H2,1H3,(H,24,27)/p+1/t18-/m1/s1 |
| InChIKey | XRDZPPUPUIOYPK-GOSISDBHSA-O |
| XLogP | 1.95 |
| TPSA | 72.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |