C17H17F2NO3 — CID 139328053
N-[(4,4-difluorocyclohexyl)methyl]-4-oxochromene-2-carboxamide (PubChem CID 139328053) has the molecular formula C17H17F2NO3 and a molecular weight of 321.32 g/mol. Its IUPAC name is N-[(4,4-difluorocyclohexyl)methyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[(4,4-difluorocyclohexyl)methyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 139328053 |
| Molecular Formula | C17H17F2NO3 |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-[(4,4-difluorocyclohexyl)methyl]-4-oxochromene-2-carboxamide |
| SMILES | O=C(NCC1CCC(F)(F)CC1)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C17H17F2NO3/c18-17(19)7-5-11(6-8-17)10-20-16(22)15-9-13(21)12-3-1-2-4-14(12)23-15/h1-4,9,11H,5-8,10H2,(H,20,22) |
| InChIKey | VVECQROJAKRNEH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |