C14H12N2O4 — CID 47102362
N'-(cyclopropanecarbonyl)-4-oxochromene-2-carbohydrazide (PubChem CID 47102362) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is N'-(cyclopropanecarbonyl)-4-oxochromene-2-carbohydrazide.
| Compound Name | N'-(cyclopropanecarbonyl)-4-oxochromene-2-carbohydrazide |
|---|---|
| PubChem CID | 47102362 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N'-(cyclopropanecarbonyl)-4-oxochromene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CC1)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C14H12N2O4/c17-10-7-12(20-11-4-2-1-3-9(10)11)14(19)16-15-13(18)8-5-6-8/h1-4,7-8H,5-6H2,(H,15,18)(H,16,19) |
| InChIKey | SZBGWOIJABPSDX-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|