C18H15NO3 — CID 3536636
N-(3,5-dimethylphenyl)-4-oxochromene-2-carboxamide (PubChem CID 3536636) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-4-oxochromene-2-carboxamide.
| Compound Name | N-(3,5-dimethylphenyl)-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 3536636 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | N-(3,5-dimethylphenyl)-4-oxochromene-2-carboxamide |
| SMILES | Cc1cc(C)cc(NC(=O)c2cc(=O)c3ccccc3o2)c1 |
| InChI | InChI=1S/C18H15NO3/c1-11-7-12(2)9-13(8-11)19-18(21)17-10-15(20)14-5-3-4-6-16(14)22-17/h3-10H,1-2H3,(H,19,21) |
| InChIKey | JDAPZGDEAHHVJE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |