C20H18N2O5 — CID 32938140
N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-4-oxochromene-2-carboxamide (PubChem CID 32938140) has the molecular formula C20H18N2O5 and a molecular weight of 366.37 g/mol. Its IUPAC name is N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 32938140 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]-4-oxochromene-2-carboxamide |
| SMILES | CCNC(=O)COc1ccc(NC(=O)c2cc(=O)c3ccccc3o2)cc1 |
| InChI | InChI=1S/C20H18N2O5/c1-2-21-19(24)12-26-14-9-7-13(8-10-14)22-20(25)18-11-16(23)15-5-3-4-6-17(15)27-18/h3-11H,2,12H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | JMPXZMYFKYDGRK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |