C27H22N2O7 — CID 42969814
[2-[4-[(4-ethoxyphenyl)carbamoyl]anilino]-2-oxoethyl] 4-oxochromene-2-carboxylate (PubChem CID 42969814) has the molecular formula C27H22N2O7 and a molecular weight of 486.48 g/mol. Its IUPAC name is [2-[4-[(4-ethoxyphenyl)carbamoyl]anilino]-2-oxoethyl] 4-oxochromene-2-carboxylate.
| Compound Name | [2-[4-[(4-ethoxyphenyl)carbamoyl]anilino]-2-oxoethyl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 42969814 |
| Molecular Formula | C27H22N2O7 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | [2-[4-[(4-ethoxyphenyl)carbamoyl]anilino]-2-oxoethyl] 4-oxochromene-2-carboxylate |
| SMILES | CCOc1ccc(NC(=O)c2ccc(NC(=O)COC(=O)c3cc(=O)c4ccccc4o3)cc2)cc1 |
| InChI | InChI=1S/C27H22N2O7/c1-2-34-20-13-11-19(12-14-20)29-26(32)17-7-9-18(10-8-17)28-25(31)16-35-27(33)24-15-22(30)21-5-3-4-6-23(21)36-24/h3-15H,2,16H2,1H3,(H,28,31)(H,29,32) |
| InChIKey | PNUFZSPDMMWACU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |