C18H12FNO5 — CID 2432321
[2-(4-fluoroanilino)-2-oxoethyl] 4-oxochromene-2-carboxylate (PubChem CID 2432321) has the molecular formula C18H12FNO5 and a molecular weight of 341.29 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxoethyl] 4-oxochromene-2-carboxylate.
| Compound Name | [2-(4-fluoroanilino)-2-oxoethyl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 2432321 |
| Molecular Formula | C18H12FNO5 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxoethyl] 4-oxochromene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc(=O)c2ccccc2o1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H12FNO5/c19-11-5-7-12(8-6-11)20-17(22)10-24-18(23)16-9-14(21)13-3-1-2-4-15(13)25-16/h1-9H,10H2,(H,20,22) |
| InChIKey | SSTXVDDMLQPBRO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |