C20H17NO5 — CID 2590864
[2-(2,3-dimethylanilino)-2-oxoethyl] 4-oxochromene-2-carboxylate (PubChem CID 2590864) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is [2-(2,3-dimethylanilino)-2-oxoethyl] 4-oxochromene-2-carboxylate.
| Compound Name | [2-(2,3-dimethylanilino)-2-oxoethyl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 2590864 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [2-(2,3-dimethylanilino)-2-oxoethyl] 4-oxochromene-2-carboxylate |
| SMILES | Cc1cccc(NC(=O)COC(=O)c2cc(=O)c3ccccc3o2)c1C |
| InChI | InChI=1S/C20H17NO5/c1-12-6-5-8-15(13(12)2)21-19(23)11-25-20(24)18-10-16(22)14-7-3-4-9-17(14)26-18/h3-10H,11H2,1-2H3,(H,21,23) |
| InChIKey | JYGYOVZAJRJIKU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |