C24H17NO6 — CID 7968561
[2-oxo-2-(2-phenoxyanilino)ethyl] 4-oxochromene-2-carboxylate (PubChem CID 7968561) has the molecular formula C24H17NO6 and a molecular weight of 415.40 g/mol. Its IUPAC name is [2-oxo-2-(2-phenoxyanilino)ethyl] 4-oxochromene-2-carboxylate.
| Compound Name | [2-oxo-2-(2-phenoxyanilino)ethyl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 7968561 |
| Molecular Formula | C24H17NO6 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | [2-oxo-2-(2-phenoxyanilino)ethyl] 4-oxochromene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc(=O)c2ccccc2o1)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C24H17NO6/c26-19-14-22(31-20-12-6-4-10-17(19)20)24(28)29-15-23(27)25-18-11-5-7-13-21(18)30-16-8-2-1-3-9-16/h1-14H,15H2,(H,25,27) |
| InChIKey | VBDPEPIGLSKOLQ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |