C19H12F3NO5 — CID 2590919
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 4-oxochromene-2-carboxylate (PubChem CID 2590919) has the molecular formula C19H12F3NO5 and a molecular weight of 391.30 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 4-oxochromene-2-carboxylate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 2590919 |
| Molecular Formula | C19H12F3NO5 |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 4-oxochromene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc(=O)c2ccccc2o1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H12F3NO5/c20-19(21,22)12-6-2-3-7-13(12)23-17(25)10-27-18(26)16-9-14(24)11-5-1-4-8-15(11)28-16/h1-9H,10H2,(H,23,25) |
| InChIKey | FQMAETKCZPFUAH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |