C17H11F6NO3 — CID 7860144
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 3-(trifluoromethyl)benzoate (PubChem CID 7860144) has the molecular formula C17H11F6NO3 and a molecular weight of 391.27 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 7860144 |
| Molecular Formula | C17H11F6NO3 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 3-(trifluoromethyl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(C(F)(F)F)c1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H11F6NO3/c18-16(19,20)11-5-3-4-10(8-11)15(26)27-9-14(25)24-13-7-2-1-6-12(13)17(21,22)23/h1-8H,9H2,(H,24,25) |
| InChIKey | WHNNHUUQIDSGAC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |