C16H10F5NO3 — CID 2504414
[2-(2,6-difluoroanilino)-2-oxoethyl] 3-(trifluoromethyl)benzoate (PubChem CID 2504414) has the molecular formula C16H10F5NO3 and a molecular weight of 359.25 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 2504414 |
| Molecular Formula | C16H10F5NO3 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 3-(trifluoromethyl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(C(F)(F)F)c1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C16H10F5NO3/c17-11-5-2-6-12(18)14(11)22-13(23)8-25-15(24)9-3-1-4-10(7-9)16(19,20)21/h1-7H,8H2,(H,22,23) |
| InChIKey | VUNYKUAFBWEFCQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |