C14H16F3NO3 — CID 2504289
[2-(tert-butylamino)-2-oxoethyl] 3-(trifluoromethyl)benzoate (PubChem CID 2504289) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 2504289 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 3-(trifluoromethyl)benzoate |
| SMILES | CC(C)(C)NC(=O)COC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F3NO3/c1-13(2,3)18-11(19)8-21-12(20)9-5-4-6-10(7-9)14(15,16)17/h4-7H,8H2,1-3H3,(H,18,19) |
| InChIKey | ZORHPOZDDFVGBQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |