About 2-methylprop-2-enyl 3-(trifluoromethyl)benzoate
2-methylprop-2-enyl 3-(trifluoromethyl)benzoate (PubChem CID 78789073) has the molecular formula C12H11F3O2
and a molecular weight of 244.21 g/mol. Its IUPAC name is 2-methylprop-2-enyl 3-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | 2-methylprop-2-enyl 3-(trifluoromethyl)benzoate |
| PubChem CID | 78789073 |
| Molecular Formula | C12H11F3O2 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-methylprop-2-enyl 3-(trifluoromethyl)benzoate |
| SMILES | C=C(C)COC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H11F3O2/c1-8(2)7-17-11(16)9-4-3-5-10(6-9)12(13,14)15/h3-6H,1,7H2,2H3 |
| InChIKey | YTEHIKQKVXBYGU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enyl 3-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enyl 3-(trifluoromethyl)benzoate?
The IUPAC name of 2-methylprop-2-enyl 3-(trifluoromethyl)benzoate (CID 78789073) is 2-methylprop-2-enyl 3-(trifluoromethyl)benzoate.
What is the SMILES notation for 2-methylprop-2-enyl 3-(trifluoromethyl)benzoate?
The canonical SMILES for 2-methylprop-2-enyl 3-(trifluoromethyl)benzoate is C=C(C)COC(=O)c1cccc(C(F)(F)F)c1.
What is the InChIKey of 2-methylprop-2-enyl 3-(trifluoromethyl)benzoate?
The InChIKey is YTEHIKQKVXBYGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11F3O2/c1-8(2)7-17-11(16)9-4-3-5-10(6-9)12(13,14)15/h3-6H,1,7H2,2H3.
What are the key properties of 2-methylprop-2-enyl 3-(trifluoromethyl)benzoate?
2-methylprop-2-enyl 3-(trifluoromethyl)benzoate has a molecular weight of 244.21 g/mol, XLogP of 3.44, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enyl 3-(trifluoromethyl)benzoate is sourced from PubChem (CID 78789073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).