C11H8Cl2F3NO2 — CID 88682315
(1,1-dichloropropan-2-ylideneamino) 3-(trifluoromethyl)benzoate (PubChem CID 88682315) has the molecular formula C11H8Cl2F3NO2 and a molecular weight of 314.09 g/mol. Its IUPAC name is (1,1-dichloropropan-2-ylideneamino) 3-(trifluoromethyl)benzoate.
| Compound Name | (1,1-dichloropropan-2-ylideneamino) 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 88682315 |
| Molecular Formula | C11H8Cl2F3NO2 |
| Molecular Weight | 314.09 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | (1,1-dichloropropan-2-ylideneamino) 3-(trifluoromethyl)benzoate |
| SMILES | CC(=NOC(=O)c1cccc(C(F)(F)F)c1)C(Cl)Cl |
| InChI | InChI=1S/C11H8Cl2F3NO2/c1-6(9(12)13)17-19-10(18)7-3-2-4-8(5-7)11(14,15)16/h2-5,9H,1H3 |
| InChIKey | SSCNOFJDIIJVAY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.09 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|