C13H13F3N2O2S2 — CID 2808357
[[amino(1,4-dithian-2-yl)methylidene]amino] 3-(trifluoromethyl)benzoate (PubChem CID 2808357) has the molecular formula C13H13F3N2O2S2 and a molecular weight of 350.39 g/mol. Its IUPAC name is [[amino(1,4-dithian-2-yl)methylidene]amino] 3-(trifluoromethyl)benzoate.
| Compound Name | [[amino(1,4-dithian-2-yl)methylidene]amino] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 2808357 |
| Molecular Formula | C13H13F3N2O2S2 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | [[amino(1,4-dithian-2-yl)methylidene]amino] 3-(trifluoromethyl)benzoate |
| SMILES | NC(=NOC(=O)c1cccc(C(F)(F)F)c1)C1CSCCS1 |
| InChI | InChI=1S/C13H13F3N2O2S2/c14-13(15,16)9-3-1-2-8(6-9)12(19)20-18-11(17)10-7-21-4-5-22-10/h1-3,6,10H,4-5,7H2,(H2,17,18) |
| InChIKey | NSIQXDCZUHYZSV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|