About piperidin-4-yl 3-(trifluoromethyl)benzoate
piperidin-4-yl 3-(trifluoromethyl)benzoate (PubChem CID 162771690) has the molecular formula C13H14F3NO2
and a molecular weight of 273.25 g/mol. Its IUPAC name is piperidin-4-yl 3-(trifluoromethyl)benzoate.
Molecular Properties
| Compound Name | piperidin-4-yl 3-(trifluoromethyl)benzoate |
| PubChem CID | 162771690 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | piperidin-4-yl 3-(trifluoromethyl)benzoate |
| SMILES | O=C(OC1CCNCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F3NO2/c14-13(15,16)10-3-1-2-9(8-10)12(18)19-11-4-6-17-7-5-11/h1-3,8,11,17H,4-7H2 |
| InChIKey | ZHMDTFNXXPMPPC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidin-4-yl 3-(trifluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-yl 3-(trifluoromethyl)benzoate?
The IUPAC name of piperidin-4-yl 3-(trifluoromethyl)benzoate (CID 162771690) is piperidin-4-yl 3-(trifluoromethyl)benzoate.
What is the SMILES notation for piperidin-4-yl 3-(trifluoromethyl)benzoate?
The canonical SMILES for piperidin-4-yl 3-(trifluoromethyl)benzoate is O=C(OC1CCNCC1)c1cccc(C(F)(F)F)c1.
What is the InChIKey of piperidin-4-yl 3-(trifluoromethyl)benzoate?
The InChIKey is ZHMDTFNXXPMPPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3NO2/c14-13(15,16)10-3-1-2-9(8-10)12(18)19-11-4-6-17-7-5-11/h1-3,8,11,17H,4-7H2.
What are the key properties of piperidin-4-yl 3-(trifluoromethyl)benzoate?
piperidin-4-yl 3-(trifluoromethyl)benzoate has a molecular weight of 273.25 g/mol, XLogP of 2.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-yl 3-(trifluoromethyl)benzoate is sourced from PubChem (CID 162771690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).