C18H17Cl3F3NO4 — CID 11751859
2,2,2-trichloroethyl (1S,5R)-3-[3-(trifluoromethyl)benzoyl]oxy-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 11751859) has the molecular formula C18H17Cl3F3NO4 and a molecular weight of 474.69 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (1S,5R)-3-[3-(trifluoromethyl)benzoyl]oxy-8-azabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (1S,5R)-3-[3-(trifluoromethyl)benzoyl]oxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 11751859 |
| Molecular Formula | C18H17Cl3F3NO4 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 473.02 |
| IUPAC Name | 2,2,2-trichloroethyl (1S,5R)-3-[3-(trifluoromethyl)benzoyl]oxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | O=C(OC1C[C@H]2CC[C@@H](C1)N2C(=O)OCC(Cl)(Cl)Cl)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17Cl3F3NO4/c19-17(20,21)9-28-16(27)25-12-4-5-13(25)8-14(7-12)29-15(26)10-2-1-3-11(6-10)18(22,23)24/h1-3,6,12-14H,4-5,7-9H2/t12-,13+,14? |
| InChIKey | ZMSJHKIEQCWLAJ-PBWFPOADSA-N |
| XLogP | 5.36 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|