C16H19F3O2 — CID 599330
(2-ethylcyclohexyl) 3-(trifluoromethyl)benzoate (PubChem CID 599330) has the molecular formula C16H19F3O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is (2-ethylcyclohexyl) 3-(trifluoromethyl)benzoate.
| Compound Name | (2-ethylcyclohexyl) 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 599330 |
| Molecular Formula | C16H19F3O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (2-ethylcyclohexyl) 3-(trifluoromethyl)benzoate |
| SMILES | CCC1CCCCC1OC(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F3O2/c1-2-11-6-3-4-9-14(11)21-15(20)12-7-5-8-13(10-12)16(17,18)19/h5,7-8,10-11,14H,2-4,6,9H2,1H3 |
| InChIKey | SHFXEBAEQMJKNM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |