C14H15F3OS — CID 2381216
2-cyclopentylsulfanyl-1-[3-(trifluoromethyl)phenyl]ethanone (PubChem CID 2381216) has the molecular formula C14H15F3OS and a molecular weight of 288.33 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-1-[3-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-cyclopentylsulfanyl-1-[3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 2381216 |
| Molecular Formula | C14H15F3OS |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-cyclopentylsulfanyl-1-[3-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(CSC1CCCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H15F3OS/c15-14(16,17)11-5-3-4-10(8-11)13(18)9-19-12-6-1-2-7-12/h3-5,8,12H,1-2,6-7,9H2 |
| InChIKey | IBOXVQUWXWKXQK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |