C15H18F3NO — CID 116584636
[2-(aminomethyl)cyclohexyl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 116584636) has the molecular formula C15H18F3NO and a molecular weight of 285.31 g/mol. Its IUPAC name is [2-(aminomethyl)cyclohexyl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [2-(aminomethyl)cyclohexyl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 116584636 |
| Molecular Formula | C15H18F3NO |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | [2-(aminomethyl)cyclohexyl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | NCC1CCCCC1C(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H18F3NO/c16-15(17,18)12-6-3-5-10(8-12)14(20)13-7-2-1-4-11(13)9-19/h3,5-6,8,11,13H,1-2,4,7,9,19H2 |
| InChIKey | ZGFHGGDJNOHBRX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |