C17H20F3N3O2 — CID 119720576
pyrrolidin-3-yl-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]methanone (PubChem CID 119720576) has the molecular formula C17H20F3N3O2 and a molecular weight of 355.36 g/mol. Its IUPAC name is pyrrolidin-3-yl-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]methanone.
| Compound Name | pyrrolidin-3-yl-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 119720576 |
| Molecular Formula | C17H20F3N3O2 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | pyrrolidin-3-yl-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)N1CCN(C(=O)C2CCNC2)CC1 |
| InChI | InChI=1S/C17H20F3N3O2/c18-17(19,20)14-3-1-2-12(10-14)15(24)22-6-8-23(9-7-22)16(25)13-4-5-21-11-13/h1-3,10,13,21H,4-9,11H2 |
| InChIKey | ZUKJRIVQOWOETB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |