C17H19F3N2O3 — CID 7346665
[(2S)-oxolan-2-yl]-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]methanone (PubChem CID 7346665) has the molecular formula C17H19F3N2O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]methanone.
| Compound Name | [(2S)-oxolan-2-yl]-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 7346665 |
| Molecular Formula | C17H19F3N2O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [(2S)-oxolan-2-yl]-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)N1CCN(C(=O)[C@@H]2CCCO2)CC1 |
| InChI | InChI=1S/C17H19F3N2O3/c18-17(19,20)13-4-1-3-12(11-13)15(23)21-6-8-22(9-7-21)16(24)14-5-2-10-25-14/h1,3-4,11,14H,2,5-10H2/t14-/m0/s1 |
| InChIKey | DMBNTIMJXGAOKB-AWEZNQCLSA-N |
| XLogP | 2.17 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |