C17H22N2O4 — CID 108547614
[4-(3-hydroxybenzoyl)-1,4-diazepan-1-yl]-(oxolan-2-yl)methanone (PubChem CID 108547614) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is [4-(3-hydroxybenzoyl)-1,4-diazepan-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-(3-hydroxybenzoyl)-1,4-diazepan-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 108547614 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | [4-(3-hydroxybenzoyl)-1,4-diazepan-1-yl]-(oxolan-2-yl)methanone |
| SMILES | O=C(c1cccc(O)c1)N1CCCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C17H22N2O4/c20-14-5-1-4-13(12-14)16(21)18-7-3-8-19(10-9-18)17(22)15-6-2-11-23-15/h1,4-5,12,15,20H,2-3,6-11H2 |
| InChIKey | DNXZWVZUOXSFFB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |