About piperidin-4-yl 4-fluorobenzoate
piperidin-4-yl 4-fluorobenzoate (PubChem CID 22921983) has the molecular formula C12H14FNO2
and a molecular weight of 223.25 g/mol. Its IUPAC name is piperidin-4-yl 4-fluorobenzoate.
Molecular Properties
| Compound Name | piperidin-4-yl 4-fluorobenzoate |
| PubChem CID | 22921983 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | piperidin-4-yl 4-fluorobenzoate |
| SMILES | O=C(OC1CCNCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H14FNO2/c13-10-3-1-9(2-4-10)12(15)16-11-5-7-14-8-6-11/h1-4,11,14H,5-8H2 |
| InChIKey | QXXFPPGDRYRNHF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidin-4-yl 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-yl 4-fluorobenzoate?
The IUPAC name of piperidin-4-yl 4-fluorobenzoate (CID 22921983) is piperidin-4-yl 4-fluorobenzoate.
What is the SMILES notation for piperidin-4-yl 4-fluorobenzoate?
The canonical SMILES for piperidin-4-yl 4-fluorobenzoate is O=C(OC1CCNCC1)c1ccc(F)cc1.
What is the InChIKey of piperidin-4-yl 4-fluorobenzoate?
The InChIKey is QXXFPPGDRYRNHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO2/c13-10-3-1-9(2-4-10)12(15)16-11-5-7-14-8-6-11/h1-4,11,14H,5-8H2.
What are the key properties of piperidin-4-yl 4-fluorobenzoate?
piperidin-4-yl 4-fluorobenzoate has a molecular weight of 223.25 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-yl 4-fluorobenzoate is sourced from PubChem (CID 22921983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).