About piperidin-4-yl 4-[(4-fluorobenzoyl)amino]benzoate;hydrochloride
piperidin-4-yl 4-[(4-fluorobenzoyl)amino]benzoate;hydrochloride (PubChem CID 91645336) has the molecular formula C19H20ClFN2O3
and a molecular weight of 378.83 g/mol. Its IUPAC name is piperidin-4-yl 4-[(4-fluorobenzoyl)amino]benzoate;hydrochloride.
Molecular Properties
| Compound Name | piperidin-4-yl 4-[(4-fluorobenzoyl)amino]benzoate;hydrochloride |
| PubChem CID | 91645336 |
| Molecular Formula | C19H20ClFN2O3 |
| Molecular Weight | 378.83 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | piperidin-4-yl 4-[(4-fluorobenzoyl)amino]benzoate;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc(C(=O)OC2CCNCC2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19FN2O3.ClH/c20-15-5-1-13(2-6-15)18(23)22-16-7-3-14(4-8-16)19(24)25-17-9-11-21-12-10-17;/h1-8,17,21H,9-12H2,(H,22,23);1H |
| InChIKey | SADXQUDNAVXWIA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.83 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperidin-4-yl 4-[(4-fluorobenzoyl)amino]benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-4-yl 4-[(4-fluorobenzoyl)amino]benzoate;hydrochloride?
The IUPAC name of piperidin-4-yl 4-[(4-fluorobenzoyl)amino]benzoate;hydrochloride (CID 91645336) is piperidin-4-yl 4-[(4-fluorobenzoyl)amino]benzoate;hydrochloride.
What is the SMILES notation for piperidin-4-yl 4-[(4-fluorobenzoyl)amino]benzoate;hydrochloride?
The canonical SMILES for piperidin-4-yl 4-[(4-fluorobenzoyl)amino]benzoate;hydrochloride is Cl.O=C(Nc1ccc(C(=O)OC2CCNCC2)cc1)c1ccc(F)cc1.
What is the InChIKey of piperidin-4-yl 4-[(4-fluorobenzoyl)amino]benzoate;hydrochloride?
The InChIKey is SADXQUDNAVXWIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19FN2O3.ClH/c20-15-5-1-13(2-6-15)18(23)22-16-7-3-14(4-8-16)19(24)25-17-9-11-21-12-10-17;/h1-8,17,21H,9-12H2,(H,22,23);1H.
What are the key properties of piperidin-4-yl 4-[(4-fluorobenzoyl)amino]benzoate;hydrochloride?
piperidin-4-yl 4-[(4-fluorobenzoyl)amino]benzoate;hydrochloride has a molecular weight of 378.83 g/mol, XLogP of 3.41, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-4-yl 4-[(4-fluorobenzoyl)amino]benzoate;hydrochloride is sourced from PubChem (CID 91645336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).