C18H20N2O4 — CID 75430151
piperidin-4-yl 4-[(3-methylfuran-2-carbonyl)amino]benzoate (PubChem CID 75430151) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is piperidin-4-yl 4-[(3-methylfuran-2-carbonyl)amino]benzoate.
| Compound Name | piperidin-4-yl 4-[(3-methylfuran-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 75430151 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | piperidin-4-yl 4-[(3-methylfuran-2-carbonyl)amino]benzoate |
| SMILES | Cc1ccoc1C(=O)Nc1ccc(C(=O)OC2CCNCC2)cc1 |
| InChI | InChI=1S/C18H20N2O4/c1-12-8-11-23-16(12)17(21)20-14-4-2-13(3-5-14)18(22)24-15-6-9-19-10-7-15/h2-5,8,11,15,19H,6-7,9-10H2,1H3,(H,20,21) |
| InChIKey | PDJUMUFYZDLSBY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |