C18H21ClN2O3S — CID 75430125
piperidin-4-yl 4-[(5-methylthiophene-2-carbonyl)amino]benzoate;hydrochloride (PubChem CID 75430125) has the molecular formula C18H21ClN2O3S and a molecular weight of 380.90 g/mol. Its IUPAC name is piperidin-4-yl 4-[(5-methylthiophene-2-carbonyl)amino]benzoate;hydrochloride.
| Compound Name | piperidin-4-yl 4-[(5-methylthiophene-2-carbonyl)amino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 75430125 |
| Molecular Formula | C18H21ClN2O3S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | piperidin-4-yl 4-[(5-methylthiophene-2-carbonyl)amino]benzoate;hydrochloride |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C(=O)OC3CCNCC3)cc2)s1.Cl |
| InChI | InChI=1S/C18H20N2O3S.ClH/c1-12-2-7-16(24-12)17(21)20-14-5-3-13(4-6-14)18(22)23-15-8-10-19-11-9-15;/h2-7,15,19H,8-11H2,1H3,(H,20,21);1H |
| InChIKey | BBKCUOGNYGDGQR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |