C16H19F3N2O3 — CID 86813781
piperidin-4-yl 4-(4,4,4-trifluorobutanoylamino)benzoate (PubChem CID 86813781) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is piperidin-4-yl 4-(4,4,4-trifluorobutanoylamino)benzoate.
| Compound Name | piperidin-4-yl 4-(4,4,4-trifluorobutanoylamino)benzoate |
|---|---|
| PubChem CID | 86813781 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | piperidin-4-yl 4-(4,4,4-trifluorobutanoylamino)benzoate |
| SMILES | O=C(CCC(F)(F)F)Nc1ccc(C(=O)OC2CCNCC2)cc1 |
| InChI | InChI=1S/C16H19F3N2O3/c17-16(18,19)8-5-14(22)21-12-3-1-11(2-4-12)15(23)24-13-6-9-20-10-7-13/h1-4,13,20H,5-10H2,(H,21,22) |
| InChIKey | VLZITDONYVJWEQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |