C27H43NO3 — CID 4274500
(4-tert-butylcyclohexyl) 4-(decanoylamino)benzoate (PubChem CID 4274500) has the molecular formula C27H43NO3 and a molecular weight of 429.65 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl) 4-(decanoylamino)benzoate.
| Compound Name | (4-tert-butylcyclohexyl) 4-(decanoylamino)benzoate |
|---|---|
| PubChem CID | 4274500 |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | (4-tert-butylcyclohexyl) 4-(decanoylamino)benzoate |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(C(=O)OC2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C27H43NO3/c1-5-6-7-8-9-10-11-12-25(29)28-23-17-13-21(14-18-23)26(30)31-24-19-15-22(16-20-24)27(2,3)4/h13-14,17-18,22,24H,5-12,15-16,19-20H2,1-4H3,(H,28,29) |
| InChIKey | SWWQJGLLNQHQEO-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|