C52H68N2O8 — CID 102213434
[4-[[10-[4-(4-octoxybenzoyl)oxyanilino]-10-oxodecanoyl]amino]phenyl] 4-octoxybenzoate (PubChem CID 102213434) has the molecular formula C52H68N2O8 and a molecular weight of 849.12 g/mol. Its IUPAC name is [4-[[10-[4-(4-octoxybenzoyl)oxyanilino]-10-oxodecanoyl]amino]phenyl] 4-octoxybenzoate.
| Compound Name | [4-[[10-[4-(4-octoxybenzoyl)oxyanilino]-10-oxodecanoyl]amino]phenyl] 4-octoxybenzoate |
|---|---|
| PubChem CID | 102213434 |
| Molecular Formula | C52H68N2O8 |
| Molecular Weight | 849.12 g/mol |
| Exact Mass | 848.50 |
| IUPAC Name | [4-[[10-[4-(4-octoxybenzoyl)oxyanilino]-10-oxodecanoyl]amino]phenyl] 4-octoxybenzoate |
| SMILES | CCCCCCCCOc1ccc(C(=O)Oc2ccc(NC(=O)CCCCCCCCC(=O)Nc3ccc(OC(=O)c4ccc(OCCCCCCCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C52H68N2O8/c1-3-5-7-9-15-19-39-59-45-31-23-41(24-32-45)51(57)61-47-35-27-43(28-36-47)53-49(55)21-17-13-11-12-14-18-22-50(56)54-44-29-37-48(38-30-44)62-52(58)42-25-33-46(34-26-42)60-40-20-16-10-8-6-4-2/h23-38H,3-22,39-40H2,1-2H3,(H,53,55)(H,54,56) |
| InChIKey | DMOARJVQPLQGKA-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.12 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|