C21H31NO4 — CID 3908689
(4-tert-butylcyclohexyl) 4-(4-methoxyanilino)-4-oxobutanoate (PubChem CID 3908689) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl) 4-(4-methoxyanilino)-4-oxobutanoate.
| Compound Name | (4-tert-butylcyclohexyl) 4-(4-methoxyanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 3908689 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | (4-tert-butylcyclohexyl) 4-(4-methoxyanilino)-4-oxobutanoate |
| SMILES | COc1ccc(NC(=O)CCC(=O)OC2CCC(C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H31NO4/c1-21(2,3)15-5-9-18(10-6-15)26-20(24)14-13-19(23)22-16-7-11-17(25-4)12-8-16/h7-8,11-12,15,18H,5-6,9-10,13-14H2,1-4H3,(H,22,23) |
| InChIKey | VTBXPCVTFDIDDZ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |