C20H29NO4 — CID 7310945
[(1S,3R,4R)-3,4-dimethylcyclohexyl] 4-(4-ethoxyanilino)-4-oxobutanoate (PubChem CID 7310945) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is [(1S,3R,4R)-3,4-dimethylcyclohexyl] 4-(4-ethoxyanilino)-4-oxobutanoate.
| Compound Name | [(1S,3R,4R)-3,4-dimethylcyclohexyl] 4-(4-ethoxyanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7310945 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | [(1S,3R,4R)-3,4-dimethylcyclohexyl] 4-(4-ethoxyanilino)-4-oxobutanoate |
| SMILES | CCOc1ccc(NC(=O)CCC(=O)O[C@H]2CC[C@@H](C)[C@H](C)C2)cc1 |
| InChI | InChI=1S/C20H29NO4/c1-4-24-17-9-6-16(7-10-17)21-19(22)11-12-20(23)25-18-8-5-14(2)15(3)13-18/h6-7,9-10,14-15,18H,4-5,8,11-13H2,1-3H3,(H,21,22)/t14-,15-,18+/m1/s1 |
| InChIKey | UVGFPVDJCRFIPE-RKVPGOIHSA-N |
| XLogP | 4.17 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |