C25H34N2O4 — CID 4507995
N,N'-bis(4-ethoxyphenyl)nonanediamide (PubChem CID 4507995) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is N,N'-bis(4-ethoxyphenyl)nonanediamide.
| Compound Name | N,N'-bis(4-ethoxyphenyl)nonanediamide |
|---|---|
| PubChem CID | 4507995 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | N,N'-bis(4-ethoxyphenyl)nonanediamide |
| SMILES | CCOc1ccc(NC(=O)CCCCCCCC(=O)Nc2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C25H34N2O4/c1-3-30-22-16-12-20(13-17-22)26-24(28)10-8-6-5-7-9-11-25(29)27-21-14-18-23(19-15-21)31-4-2/h12-19H,3-11H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | WSNVNPGISGURML-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|