C14H20N4O2 — CID 42612189
6-azido-N-(4-ethoxyphenyl)hexanamide (PubChem CID 42612189) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 6-azido-N-(4-ethoxyphenyl)hexanamide.
| Compound Name | 6-azido-N-(4-ethoxyphenyl)hexanamide |
|---|---|
| PubChem CID | 42612189 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 6-azido-N-(4-ethoxyphenyl)hexanamide |
| SMILES | CCOc1ccc(NC(=O)CCCCCN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C14H20N4O2/c1-2-20-13-9-7-12(8-10-13)17-14(19)6-4-3-5-11-16-18-15/h7-10H,2-6,11H2,1H3,(H,17,19) |
| InChIKey | AZYWOEZEHFGPTD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|