C18H20N4O2 — CID 42612296
6-azido-N-(4-phenoxyphenyl)hexanamide (PubChem CID 42612296) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 6-azido-N-(4-phenoxyphenyl)hexanamide.
| Compound Name | 6-azido-N-(4-phenoxyphenyl)hexanamide |
|---|---|
| PubChem CID | 42612296 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 6-azido-N-(4-phenoxyphenyl)hexanamide |
| SMILES | [N-]=[N+]=NCCCCCC(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H20N4O2/c19-22-20-14-6-2-5-9-18(23)21-15-10-12-17(13-11-15)24-16-7-3-1-4-8-16/h1,3-4,7-8,10-13H,2,5-6,9,14H2,(H,21,23) |
| InChIKey | QKRBRDQBHIGGFN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|